C28H28N2 — CID 59140430
4-(2,2-dimethylbut-3-enyl)-1-tritylimidazole (PubChem CID 59140430) has the molecular formula C28H28N2 and a molecular weight of 392.55 g/mol. Its IUPAC name is 4-(2,2-dimethylbut-3-enyl)-1-tritylimidazole.
| Compound Name | 4-(2,2-dimethylbut-3-enyl)-1-tritylimidazole |
|---|---|
| PubChem CID | 59140430 |
| Molecular Formula | C28H28N2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 4-(2,2-dimethylbut-3-enyl)-1-tritylimidazole |
| SMILES | C=CC(C)(C)Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C28H28N2/c1-4-27(2,3)20-26-21-30(22-29-26)28(23-14-8-5-9-15-23,24-16-10-6-11-17-24)25-18-12-7-13-19-25/h4-19,21-22H,1,20H2,2-3H3 |
| InChIKey | NRWGMIKJGHWQIJ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|