C41H42N4O3 — CID 134349199
3-[benzyl(formyl)amino]-N-(cyclohexylmethyl)-2-oxo-4-(1-tritylimidazol-4-yl)butanamide (PubChem CID 134349199) has the molecular formula C41H42N4O3 and a molecular weight of 638.81 g/mol. Its IUPAC name is 3-[benzyl(formyl)amino]-N-(cyclohexylmethyl)-2-oxo-4-(1-tritylimidazol-4-yl)butanamide.
| Compound Name | 3-[benzyl(formyl)amino]-N-(cyclohexylmethyl)-2-oxo-4-(1-tritylimidazol-4-yl)butanamide |
|---|---|
| PubChem CID | 134349199 |
| Molecular Formula | C41H42N4O3 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.33 |
| IUPAC Name | 3-[benzyl(formyl)amino]-N-(cyclohexylmethyl)-2-oxo-4-(1-tritylimidazol-4-yl)butanamide |
| SMILES | O=CN(Cc1ccccc1)C(Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)C(=O)C(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C41H42N4O3/c46-31-44(28-33-18-8-2-9-19-33)38(39(47)40(48)42-27-32-16-6-1-7-17-32)26-37-29-45(30-43-37)41(34-20-10-3-11-21-34,35-22-12-4-13-23-35)36-24-14-5-15-25-36/h2-5,8-15,18-25,29-32,38H,1,6-7,16-17,26-28H2,(H,42,48) |
| InChIKey | ZTWZUDCSMAPYSC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|