C49H48N4O8 — CID 16663514
(2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (PubChem CID 16663514) has the molecular formula C49H48N4O8 and a molecular weight of 820.94 g/mol. Its IUPAC name is (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid.
| Compound Name | (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 16663514 |
| Molecular Formula | C49H48N4O8 |
| Molecular Weight | 820.94 g/mol |
| Exact Mass | 820.35 |
| IUPAC Name | (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(1-tritylimidazol-4-yl)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| SMILES | C[C@@H](OC(=O)[C@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)OCC1c2ccccc2-c2ccccc21)[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C49H48N4O8/c1-32(43(44(54)55)52-47(58)61-48(2,3)4)60-45(56)42(51-46(57)59-30-41-39-26-16-14-24-37(39)38-25-15-17-27-40(38)41)28-36-29-53(31-50-36)49(33-18-8-5-9-19-33,34-20-10-6-11-21-34)35-22-12-7-13-23-35/h5-27,29,31-32,41-43H,28,30H2,1-4H3,(H,51,57)(H,52,58)(H,54,55)/t32-,42+,43+/m1/s1 |
| InChIKey | HCPDCTCPUTYOTF-NZQDFUIRSA-N |
| XLogP | 8.08 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.94 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|