C24H28N2O6 — CID 87830965
[2-acetamido-2-(acetyloxymethyl)-4-[4-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]butyl] acetate (PubChem CID 87830965) has the molecular formula C24H28N2O6 and a molecular weight of 440.50 g/mol. Its IUPAC name is [2-acetamido-2-(acetyloxymethyl)-4-[4-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]butyl] acetate.
| Compound Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]butyl] acetate |
|---|---|
| PubChem CID | 87830965 |
| Molecular Formula | C24H28N2O6 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | [2-acetamido-2-(acetyloxymethyl)-4-[4-[4-[(Z)-hydroxyiminomethyl]phenyl]phenyl]butyl] acetate |
| SMILES | CC(=O)NC(CCc1ccc(-c2ccc(/C=N\O)cc2)cc1)(COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C24H28N2O6/c1-17(27)26-24(15-31-18(2)28,16-32-19(3)29)13-12-20-4-8-22(9-5-20)23-10-6-21(7-11-23)14-25-30/h4-11,14,30H,12-13,15-16H2,1-3H3,(H,26,27)/b25-14- |
| InChIKey | CVAYKIJQGJUKRK-QFEZKATASA-N |
| XLogP | 3.10 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|