C21H34FNO3 — CID 90219305
N-[4-[4-(8-fluorooctyl)phenyl]-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide (PubChem CID 90219305) has the molecular formula C21H34FNO3 and a molecular weight of 367.51 g/mol. Its IUPAC name is N-[4-[4-(8-fluorooctyl)phenyl]-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide.
| Compound Name | N-[4-[4-(8-fluorooctyl)phenyl]-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 90219305 |
| Molecular Formula | C21H34FNO3 |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | N-[4-[4-(8-fluorooctyl)phenyl]-1-hydroxy-2-(hydroxymethyl)butan-2-yl]acetamide |
| SMILES | CC(=O)NC(CO)(CO)CCc1ccc(CCCCCCCCF)cc1 |
| InChI | InChI=1S/C21H34FNO3/c1-18(26)23-21(16-24,17-25)14-13-20-11-9-19(10-12-20)8-6-4-2-3-5-7-15-22/h9-12,24-25H,2-8,13-17H2,1H3,(H,23,26) |
| InChIKey | ASBRJIOJQRTPHC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|