C25H29ClNO5PS — CID 58672855
[2-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate (PubChem CID 58672855) has the molecular formula C25H29ClNO5PS and a molecular weight of 522.00 g/mol. Its IUPAC name is [2-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate.
| Compound Name | [2-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 58672855 |
| Molecular Formula | C25H29ClNO5PS |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | [2-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylpentyl] dihydrogen phosphate |
| SMILES | CC(N)(CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)COP(=O)(O)O |
| InChI | InChI=1S/C25H29ClNO5PS/c1-25(27,18-32-33(28,29)30)14-6-9-20-12-13-23(16-24(20)26)34-22-11-5-10-21(15-22)31-17-19-7-3-2-4-8-19/h2-5,7-8,10-13,15-16H,6,9,14,17-18,27H2,1H3,(H2,28,29,30) |
| InChIKey | LNJIJROSVQOZIY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|