C24H27ClNO6PS — CID 51529911
[(2R)-2-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate (PubChem CID 51529911) has the molecular formula C24H27ClNO6PS and a molecular weight of 523.98 g/mol. Its IUPAC name is [(2R)-2-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 51529911 |
| Molecular Formula | C24H27ClNO6PS |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | [(2R)-2-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-(hydroxymethyl)butyl] dihydrogen phosphate |
| SMILES | N[C@@](CO)(CCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)COP(=O)(O)O |
| InChI | InChI=1S/C24H27ClNO6PS/c25-23-14-22(10-9-19(23)11-12-24(26,16-27)17-32-33(28,29)30)34-21-8-4-7-20(13-21)31-15-18-5-2-1-3-6-18/h1-10,13-14,27H,11-12,15-17,26H2,(H2,28,29,30)/t24-/m1/s1 |
| InChIKey | JZHXIFZZZFFZBQ-XMMPIXPASA-N |
| XLogP | 4.80 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|