C29H29ClO4S — CID 23078193
methyl 2-[3-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]propyl]-2-(hydroxymethyl)pent-4-ynoate (PubChem CID 23078193) has the molecular formula C29H29ClO4S and a molecular weight of 509.07 g/mol. Its IUPAC name is methyl 2-[3-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]propyl]-2-(hydroxymethyl)pent-4-ynoate.
| Compound Name | methyl 2-[3-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]propyl]-2-(hydroxymethyl)pent-4-ynoate |
|---|---|
| PubChem CID | 23078193 |
| Molecular Formula | C29H29ClO4S |
| Molecular Weight | 509.07 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | methyl 2-[3-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]propyl]-2-(hydroxymethyl)pent-4-ynoate |
| SMILES | C#CCC(CO)(CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)C(=O)OC |
| InChI | InChI=1S/C29H29ClO4S/c1-3-16-29(21-31,28(32)33-2)17-8-11-23-14-15-26(19-27(23)30)35-25-13-7-12-24(18-25)34-20-22-9-5-4-6-10-22/h1,4-7,9-10,12-15,18-19,31H,8,11,16-17,20-21H2,2H3 |
| InChIKey | XCYBTGNTENDNLV-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.07 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|