C32H38ClNO4S — CID 91004743
tert-butyl N-[7-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-4-(hydroxymethyl)hept-2-en-4-yl]carbamate (PubChem CID 91004743) has the molecular formula C32H38ClNO4S and a molecular weight of 568.18 g/mol. Its IUPAC name is tert-butyl N-[7-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-4-(hydroxymethyl)hept-2-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[7-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-4-(hydroxymethyl)hept-2-en-4-yl]carbamate |
|---|---|
| PubChem CID | 91004743 |
| Molecular Formula | C32H38ClNO4S |
| Molecular Weight | 568.18 g/mol |
| Exact Mass | 567.22 |
| IUPAC Name | tert-butyl N-[7-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-4-(hydroxymethyl)hept-2-en-4-yl]carbamate |
| SMILES | CC=CC(CO)(CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H38ClNO4S/c1-5-18-32(23-35,34-30(36)38-31(2,3)4)19-10-13-25-16-17-28(21-29(25)33)39-27-15-9-14-26(20-27)37-22-24-11-7-6-8-12-24/h5-9,11-12,14-18,20-21,35H,10,13,19,22-23H2,1-4H3,(H,34,36) |
| InChIKey | XGMJKMVUAXTFDH-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.18 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|