C25H29ClNO4PS — CID 161057926
5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methyl-1-phosphorosooxypentan-2-amine;hydrate (PubChem CID 161057926) has the molecular formula C25H29ClNO4PS and a molecular weight of 506.00 g/mol. Its IUPAC name is 5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methyl-1-phosphorosooxypentan-2-amine;hydrate.
| Compound Name | 5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methyl-1-phosphorosooxypentan-2-amine;hydrate |
|---|---|
| PubChem CID | 161057926 |
| Molecular Formula | C25H29ClNO4PS |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | 5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methyl-1-phosphorosooxypentan-2-amine;hydrate |
| SMILES | CC(N)(CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)COP=O.O |
| InChI | InChI=1S/C25H27ClNO3PS.H2O/c1-25(27,18-30-31-28)14-6-9-20-12-13-23(16-24(20)26)32-22-11-5-10-21(15-22)29-17-19-7-3-2-4-8-19;/h2-5,7-8,10-13,15-16H,6,9,14,17-18,27H2,1H3;1H2 |
| InChIKey | STSAYPPIZHORHT-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|