C24H26ClNO2S — CID 141165630
1-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylbutan-1-ol (PubChem CID 141165630) has the molecular formula C24H26ClNO2S and a molecular weight of 428.00 g/mol. Its IUPAC name is 1-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylbutan-1-ol.
| Compound Name | 1-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylbutan-1-ol |
|---|---|
| PubChem CID | 141165630 |
| Molecular Formula | C24H26ClNO2S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-amino-4-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-2-methylbutan-1-ol |
| SMILES | CC(CCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)C(N)O |
| InChI | InChI=1S/C24H26ClNO2S/c1-17(24(26)27)10-11-19-12-13-22(15-23(19)25)29-21-9-5-8-20(14-21)28-16-18-6-3-2-4-7-18/h2-9,12-15,17,24,27H,10-11,16,26H2,1H3 |
| InChIKey | IDDJLBZBZJDHNS-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|