C25H28ClNO3S — CID 68671243
5-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]hexane-1,3-diol (PubChem CID 68671243) has the molecular formula C25H28ClNO3S and a molecular weight of 458.02 g/mol. Its IUPAC name is 5-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]hexane-1,3-diol.
| Compound Name | 5-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]hexane-1,3-diol |
|---|---|
| PubChem CID | 68671243 |
| Molecular Formula | C25H28ClNO3S |
| Molecular Weight | 458.02 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 5-amino-5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]hexane-1,3-diol |
| SMILES | CC(N)(CC(O)CCO)c1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C25H28ClNO3S/c1-25(27,16-19(29)12-13-28)23-11-10-22(15-24(23)26)31-21-9-5-8-20(14-21)30-17-18-6-3-2-4-7-18/h2-11,14-15,19,28-29H,12-13,16-17,27H2,1H3 |
| InChIKey | HDZHTSPCWJHFLR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |