C25H29NO4 — CID 68518561
5-amino-5-[4-(3-phenylmethoxyphenoxy)phenyl]hexane-1,3-diol (PubChem CID 68518561) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 5-amino-5-[4-(3-phenylmethoxyphenoxy)phenyl]hexane-1,3-diol.
| Compound Name | 5-amino-5-[4-(3-phenylmethoxyphenoxy)phenyl]hexane-1,3-diol |
|---|---|
| PubChem CID | 68518561 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 5-amino-5-[4-(3-phenylmethoxyphenoxy)phenyl]hexane-1,3-diol |
| SMILES | CC(N)(CC(O)CCO)c1ccc(Oc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H29NO4/c1-25(26,17-21(28)14-15-27)20-10-12-22(13-11-20)30-24-9-5-8-23(16-24)29-18-19-6-3-2-4-7-19/h2-13,16,21,27-28H,14-15,17-18,26H2,1H3 |
| InChIKey | NVFZSIXUSZJTHB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |