C17H21NO2 — CID 139820128
(1S,2R)-2-amino-1-(2-methyl-4-phenylmethoxyphenyl)propan-1-ol (PubChem CID 139820128) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1S,2R)-2-amino-1-(2-methyl-4-phenylmethoxyphenyl)propan-1-ol.
| Compound Name | (1S,2R)-2-amino-1-(2-methyl-4-phenylmethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 139820128 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (1S,2R)-2-amino-1-(2-methyl-4-phenylmethoxyphenyl)propan-1-ol |
| SMILES | Cc1cc(OCc2ccccc2)ccc1[C@H](O)[C@@H](C)N |
| InChI | InChI=1S/C17H21NO2/c1-12-10-15(8-9-16(12)17(19)13(2)18)20-11-14-6-4-3-5-7-14/h3-10,13,17,19H,11,18H2,1-2H3/t13-,17-/m1/s1 |
| InChIKey | VSOJHMFJDRGUAX-CXAGYDPISA-N |
| XLogP | 2.95 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |