C23H24FNO3 — CID 541841
2-amino-1-[2-fluoro-4,5-bis(phenylmethoxy)phenyl]propan-1-ol (PubChem CID 541841) has the molecular formula C23H24FNO3 and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-amino-1-[2-fluoro-4,5-bis(phenylmethoxy)phenyl]propan-1-ol.
| Compound Name | 2-amino-1-[2-fluoro-4,5-bis(phenylmethoxy)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 541841 |
| Molecular Formula | C23H24FNO3 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-amino-1-[2-fluoro-4,5-bis(phenylmethoxy)phenyl]propan-1-ol |
| SMILES | CC(N)C(O)c1cc(OCc2ccccc2)c(OCc2ccccc2)cc1F |
| InChI | InChI=1S/C23H24FNO3/c1-16(25)23(26)19-12-21(27-14-17-8-4-2-5-9-17)22(13-20(19)24)28-15-18-10-6-3-7-11-18/h2-13,16,23,26H,14-15,25H2,1H3 |
| InChIKey | OINMPXYSVIEUSL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |