C22H23ClNO6PS — CID 134597140
[(2S)-2-amino-2-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-hydroxypropyl] dihydrogen phosphate (PubChem CID 134597140) has the molecular formula C22H23ClNO6PS and a molecular weight of 495.92 g/mol. Its IUPAC name is [(2S)-2-amino-2-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-hydroxypropyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-hydroxypropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 134597140 |
| Molecular Formula | C22H23ClNO6PS |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | [(2S)-2-amino-2-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-hydroxypropyl] dihydrogen phosphate |
| SMILES | N[C@@](CO)(COP(=O)(O)O)c1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C22H23ClNO6PS/c23-21-12-19(9-10-20(21)22(24,14-25)15-30-31(26,27)28)32-18-8-4-7-17(11-18)29-13-16-5-2-1-3-6-16/h1-12,25H,13-15,24H2,(H2,26,27,28)/t22-/m0/s1 |
| InChIKey | FGUZOLSSDKWREK-QFIPXVFZSA-N |
| XLogP | 4.33 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|