2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride

C21H17ClO2S — CID 87260314

IUPAC2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride
SMILESO=C(Cl)Cc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1
InChIInChI=1S/C21H17ClO2S/c22-21(23)13-16-9-11-19(12-10-16)25-20-8-4-7-18(14-20)24-15-17-5-2-1-3-6-17/h1-12,14H,13,15H2
InChIKeyKNCSIKXWQPTLEO-UHFFFAOYSA-N
MW368.89 g/mol
LogP5.72
Rot. Bonds7

About 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride

2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride (PubChem CID 87260314) has the molecular formula C21H17ClO2S and a molecular weight of 368.89 g/mol. Its IUPAC name is 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride.

Molecular Properties

Compound Name2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride
PubChem CID87260314
Molecular FormulaC21H17ClO2S
Molecular Weight368.89 g/mol
Exact Mass368.06
IUPAC Name2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride
SMILESO=C(Cl)Cc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1
InChIInChI=1S/C21H17ClO2S/c22-21(23)13-16-9-11-19(12-10-16)25-20-8-4-7-18(14-20)24-15-17-5-2-1-3-6-17/h1-12,14H,13,15H2
InChIKeyKNCSIKXWQPTLEO-UHFFFAOYSA-N
XLogP5.72
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.89
LogP ≤ 55.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride?
The IUPAC name of 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride (CID 87260314) is 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride.
What is the SMILES notation for 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride?
The canonical SMILES for 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride is O=C(Cl)Cc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1.
What is the InChIKey of 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride?
The InChIKey is KNCSIKXWQPTLEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClO2S/c22-21(23)13-16-9-11-19(12-10-16)25-20-8-4-7-18(14-20)24-15-17-5-2-1-3-6-17/h1-12,14H,13,15H2.
What are the key properties of 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride?
2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride has a molecular weight of 368.89 g/mol, XLogP of 5.72, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3-phenylmethoxyphenyl)sulfanylphenyl]acetyl chloride is sourced from PubChem (CID 87260314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).