C24H22ClN2O5PS2 — CID 143625292
[(2S)-2-amino-2-[5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1,3-thiazol-2-yl]ethyl] dihydrogen phosphate (PubChem CID 143625292) has the molecular formula C24H22ClN2O5PS2 and a molecular weight of 549.01 g/mol. Its IUPAC name is [(2S)-2-amino-2-[5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1,3-thiazol-2-yl]ethyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-amino-2-[5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1,3-thiazol-2-yl]ethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 143625292 |
| Molecular Formula | C24H22ClN2O5PS2 |
| Molecular Weight | 549.01 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | [(2S)-2-amino-2-[5-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1,3-thiazol-2-yl]ethyl] dihydrogen phosphate |
| SMILES | N[C@@H](COP(=O)(O)O)c1ncc(-c2ccc(Sc3cccc(OCc4ccccc4)c3)cc2Cl)s1 |
| InChI | InChI=1S/C24H22ClN2O5PS2/c25-21-12-19(34-18-8-4-7-17(11-18)31-14-16-5-2-1-3-6-16)9-10-20(21)23-13-27-24(35-23)22(26)15-32-33(28,29)30/h1-13,22H,14-15,26H2,(H2,28,29,30)/t22-/m0/s1 |
| InChIKey | GAQIGKHJOACTQI-QFIPXVFZSA-N |
| XLogP | 6.30 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.01 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|