C29H36Cl2NO4PS — CID 131727194
6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1-diethoxyphosphorylhex-1-en-3-amine;hydrochloride (PubChem CID 131727194) has the molecular formula C29H36Cl2NO4PS and a molecular weight of 596.56 g/mol. Its IUPAC name is 6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1-diethoxyphosphorylhex-1-en-3-amine;hydrochloride.
| Compound Name | 6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1-diethoxyphosphorylhex-1-en-3-amine;hydrochloride |
|---|---|
| PubChem CID | 131727194 |
| Molecular Formula | C29H36Cl2NO4PS |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-1-diethoxyphosphorylhex-1-en-3-amine;hydrochloride |
| SMILES | CCOP(=O)(C=CC(N)CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl)OCC.Cl |
| InChI | InChI=1S/C29H35ClNO4PS.ClH/c1-3-34-36(32,35-4-2)19-18-25(31)13-8-12-24-16-17-28(21-29(24)30)37-27-15-9-14-26(20-27)33-22-23-10-6-5-7-11-23;/h5-7,9-11,14-21,25H,3-4,8,12-13,22,31H2,1-2H3;1H |
| InChIKey | ZWGKRCBAGLBJBV-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|