C28H33ClNO4PS — CID 23094189
[(E)-3-amino-6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-propylhex-1-enyl]phosphonic acid (PubChem CID 23094189) has the molecular formula C28H33ClNO4PS and a molecular weight of 546.07 g/mol. Its IUPAC name is [(E)-3-amino-6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-propylhex-1-enyl]phosphonic acid.
| Compound Name | [(E)-3-amino-6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-propylhex-1-enyl]phosphonic acid |
|---|---|
| PubChem CID | 23094189 |
| Molecular Formula | C28H33ClNO4PS |
| Molecular Weight | 546.07 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | [(E)-3-amino-6-[2-chloro-4-(3-phenylmethoxyphenyl)sulfanylphenyl]-3-propylhex-1-enyl]phosphonic acid |
| SMILES | CCCC(N)(/C=C/P(=O)(O)O)CCCc1ccc(Sc2cccc(OCc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C28H33ClNO4PS/c1-2-15-28(30,17-18-35(31,32)33)16-7-10-23-13-14-26(20-27(23)29)36-25-12-6-11-24(19-25)34-21-22-8-4-3-5-9-22/h3-6,8-9,11-14,17-20H,2,7,10,15-16,21,30H2,1H3,(H2,31,32,33)/b18-17+ |
| InChIKey | ZZVPOGZMJLCUNZ-ISLYRVAYSA-N |
| XLogP | 7.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.07 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|