C21H29NaO2S — CID 173398907
sodium;hydride;5-[5-(6-phenylhexyl)thiophen-2-yl]pentanoic acid (PubChem CID 173398907) has the molecular formula C21H29NaO2S and a molecular weight of 368.52 g/mol. Its IUPAC name is sodium;hydride;5-[5-(6-phenylhexyl)thiophen-2-yl]pentanoic acid.
| Compound Name | sodium;hydride;5-[5-(6-phenylhexyl)thiophen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 173398907 |
| Molecular Formula | C21H29NaO2S |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | sodium;hydride;5-[5-(6-phenylhexyl)thiophen-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1ccc(CCCCCCc2ccccc2)s1.[H-].[Na+] |
| InChI | InChI=1S/C21H28O2S.Na.H/c22-21(23)15-9-8-14-20-17-16-19(24-20)13-7-2-1-4-10-18-11-5-3-6-12-18;;/h3,5-6,11-12,16-17H,1-2,4,7-10,13-15H2,(H,22,23);;/q;+1;-1 |
| InChIKey | AZLBWAUGZDPWQA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|