C19H31ClNO5P — CID 71070557
[(2S,4S)-4-(2-chloro-4-octylphenoxy)pyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 71070557) has the molecular formula C19H31ClNO5P and a molecular weight of 419.89 g/mol. Its IUPAC name is [(2S,4S)-4-(2-chloro-4-octylphenoxy)pyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2S,4S)-4-(2-chloro-4-octylphenoxy)pyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 71070557 |
| Molecular Formula | C19H31ClNO5P |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | [(2S,4S)-4-(2-chloro-4-octylphenoxy)pyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | CCCCCCCCc1ccc(O[C@@H]2CN[C@H](COP(=O)(O)O)C2)c(Cl)c1 |
| InChI | InChI=1S/C19H31ClNO5P/c1-2-3-4-5-6-7-8-15-9-10-19(18(20)11-15)26-17-12-16(21-13-17)14-25-27(22,23)24/h9-11,16-17,21H,2-8,12-14H2,1H3,(H2,22,23,24)/t16-,17-/m0/s1 |
| InChIKey | YVNCVGOTPOQHGM-IRXDYDNUSA-N |
| XLogP | 4.46 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|