About 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol
2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol (PubChem CID 143734026) has the molecular formula C19H32ClNO2
and a molecular weight of 341.92 g/mol. Its IUPAC name is 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol.
Molecular Properties
| Compound Name | 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol |
| PubChem CID | 143734026 |
| Molecular Formula | C19H32ClNO2 |
| Molecular Weight | 341.92 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol |
| SMILES | CCCCCCCCc1ccc(O)c(Cl)c1.OCC1CCCN1 |
| InChI | InChI=1S/C14H21ClO.C5H11NO/c1-2-3-4-5-6-7-8-12-9-10-14(16)13(15)11-12;7-4-5-2-1-3-6-5/h9-11,16H,2-8H2,1H3;5-7H,1-4H2 |
| InChIKey | IVKMHFQTDAJGOI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.92 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol?
The IUPAC name of 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol (CID 143734026) is 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol.
What is the SMILES notation for 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol?
The canonical SMILES for 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol is CCCCCCCCc1ccc(O)c(Cl)c1.OCC1CCCN1.
What is the InChIKey of 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol?
The InChIKey is IVKMHFQTDAJGOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21ClO.C5H11NO/c1-2-3-4-5-6-7-8-12-9-10-14(16)13(15)11-12;7-4-5-2-1-3-6-5/h9-11,16H,2-8H2,1H3;5-7H,1-4H2.
What are the key properties of 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol?
2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol has a molecular weight of 341.92 g/mol, XLogP of 4.68, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-octylphenol;pyrrolidin-2-ylmethanol is sourced from PubChem (CID 143734026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).