C20H33F3NO5P — CID 71070418
[(2R)-2-[[(2S)-2-[4-heptyl-3-(trifluoromethyl)phenoxy]propyl]amino]propyl] dihydrogen phosphate (PubChem CID 71070418) has the molecular formula C20H33F3NO5P and a molecular weight of 455.45 g/mol. Its IUPAC name is [(2R)-2-[[(2S)-2-[4-heptyl-3-(trifluoromethyl)phenoxy]propyl]amino]propyl] dihydrogen phosphate.
| Compound Name | [(2R)-2-[[(2S)-2-[4-heptyl-3-(trifluoromethyl)phenoxy]propyl]amino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 71070418 |
| Molecular Formula | C20H33F3NO5P |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | [(2R)-2-[[(2S)-2-[4-heptyl-3-(trifluoromethyl)phenoxy]propyl]amino]propyl] dihydrogen phosphate |
| SMILES | CCCCCCCc1ccc(O[C@@H](C)CN[C@H](C)COP(=O)(O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C20H33F3NO5P/c1-4-5-6-7-8-9-17-10-11-18(12-19(17)20(21,22)23)29-16(3)13-24-15(2)14-28-30(25,26)27/h10-12,15-16,24H,4-9,13-14H2,1-3H3,(H2,25,26,27)/t15-,16+/m1/s1 |
| InChIKey | UQTYLEFWKDGYMB-CVEARBPZSA-N |
| XLogP | 5.07 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|