C20H41NO4 — CID 70583370
(1S,3R,4S,5R)-4-[heptyl(methyl)amino]-5-(2-hydroxyheptoxy)cyclopentane-1,3-diol (PubChem CID 70583370) has the molecular formula C20H41NO4 and a molecular weight of 359.55 g/mol. Its IUPAC name is (1S,3R,4S,5R)-4-[heptyl(methyl)amino]-5-(2-hydroxyheptoxy)cyclopentane-1,3-diol.
| Compound Name | (1S,3R,4S,5R)-4-[heptyl(methyl)amino]-5-(2-hydroxyheptoxy)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 70583370 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | (1S,3R,4S,5R)-4-[heptyl(methyl)amino]-5-(2-hydroxyheptoxy)cyclopentane-1,3-diol |
| SMILES | CCCCCCCN(C)[C@@H]1[C@@H](OCC(O)CCCCC)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H41NO4/c1-4-6-8-9-11-13-21(3)19-17(23)14-18(24)20(19)25-15-16(22)12-10-7-5-2/h16-20,22-24H,4-15H2,1-3H3/t16?,17-,18+,19+,20+/m1/s1 |
| InChIKey | SCHGNKFJAPKEEH-AIPWLVHISA-N |
| XLogP | 2.71 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|