C36H57NO3 — CID 57028072
(1S,2R,4S)-N-heptyl-N-methyl-1-nonoxy-2,4-bis(phenylmethoxy)cyclopentan-1-amine (PubChem CID 57028072) has the molecular formula C36H57NO3 and a molecular weight of 551.86 g/mol. Its IUPAC name is (1S,2R,4S)-N-heptyl-N-methyl-1-nonoxy-2,4-bis(phenylmethoxy)cyclopentan-1-amine.
| Compound Name | (1S,2R,4S)-N-heptyl-N-methyl-1-nonoxy-2,4-bis(phenylmethoxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 57028072 |
| Molecular Formula | C36H57NO3 |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.43 |
| IUPAC Name | (1S,2R,4S)-N-heptyl-N-methyl-1-nonoxy-2,4-bis(phenylmethoxy)cyclopentan-1-amine |
| SMILES | CCCCCCCCCO[C@@]1(N(C)CCCCCCC)C[C@@H](OCc2ccccc2)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C36H57NO3/c1-4-6-8-10-11-13-21-27-40-36(37(3)26-20-12-9-7-5-2)29-34(38-30-32-22-16-14-17-23-32)28-35(36)39-31-33-24-18-15-19-25-33/h14-19,22-25,34-35H,4-13,20-21,26-31H2,1-3H3/t34-,35+,36-/m0/s1 |
| InChIKey | OKVPTPMNRKHYDC-PDHQKIGBSA-N |
| XLogP | 9.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|