C18H37NO3 — CID 57080067
(1R,3S,4R)-4-[heptyl(methyl)amino]-4-pentoxycyclopentane-1,3-diol (PubChem CID 57080067) has the molecular formula C18H37NO3 and a molecular weight of 315.50 g/mol. Its IUPAC name is (1R,3S,4R)-4-[heptyl(methyl)amino]-4-pentoxycyclopentane-1,3-diol.
| Compound Name | (1R,3S,4R)-4-[heptyl(methyl)amino]-4-pentoxycyclopentane-1,3-diol |
|---|---|
| PubChem CID | 57080067 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | (1R,3S,4R)-4-[heptyl(methyl)amino]-4-pentoxycyclopentane-1,3-diol |
| SMILES | CCCCCCCN(C)[C@@]1(OCCCCC)C[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C18H37NO3/c1-4-6-8-9-10-12-19(3)18(22-13-11-7-5-2)15-16(20)14-17(18)21/h16-17,20-21H,4-15H2,1-3H3/t16-,17+,18-/m1/s1 |
| InChIKey | MIRMKWLSGOVIJM-FGTMMUONSA-N |
| XLogP | 3.31 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|