C15H25N — CID 101048002
N-benzyl-N-methylheptan-2-amine (PubChem CID 101048002) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is N-benzyl-N-methylheptan-2-amine.
| Compound Name | N-benzyl-N-methylheptan-2-amine |
|---|---|
| PubChem CID | 101048002 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-benzyl-N-methylheptan-2-amine |
| SMILES | CCCCCC(C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H25N/c1-4-5-7-10-14(2)16(3)13-15-11-8-6-9-12-15/h6,8-9,11-12,14H,4-5,7,10,13H2,1-3H3 |
| InChIKey | DFPKDHGEBQHUMR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|