C48H54O8 — CID 139811920
ethyl 6-[2-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-phenylmethoxyphenoxy]hexanoate (PubChem CID 139811920) has the molecular formula C48H54O8 and a molecular weight of 758.95 g/mol. Its IUPAC name is ethyl 6-[2-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-phenylmethoxyphenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-phenylmethoxyphenoxy]hexanoate |
|---|---|
| PubChem CID | 139811920 |
| Molecular Formula | C48H54O8 |
| Molecular Weight | 758.95 g/mol |
| Exact Mass | 758.38 |
| IUPAC Name | ethyl 6-[2-[(2R,3R,4R,5R,6S)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-5-phenylmethoxyphenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1cc(OCc2ccccc2)ccc1[C@H]1O[C@@H](C)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C48H54O8/c1-3-50-44(49)27-17-8-18-30-51-43-31-41(52-32-37-19-9-4-10-20-37)28-29-42(43)46-48(55-35-40-25-15-7-16-26-40)47(54-34-39-23-13-6-14-24-39)45(36(2)56-46)53-33-38-21-11-5-12-22-38/h4-7,9-16,19-26,28-29,31,36,45-48H,3,8,17-18,27,30,32-35H2,1-2H3/t36-,45+,46+,47+,48?/m0/s1 |
| InChIKey | ZPLNWNJFZHGVLD-UFANJPLMSA-N |
| XLogP | 9.98 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.95 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|