C42H42O8 — CID 139096062
1-[2,6-dihydroxy-3-[(2S,3S,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-4-phenylmethoxyphenyl]ethanone (PubChem CID 139096062) has the molecular formula C42H42O8 and a molecular weight of 674.79 g/mol. Its IUPAC name is 1-[2,6-dihydroxy-3-[(2S,3S,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-4-phenylmethoxyphenyl]ethanone.
| Compound Name | 1-[2,6-dihydroxy-3-[(2S,3S,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-4-phenylmethoxyphenyl]ethanone |
|---|---|
| PubChem CID | 139096062 |
| Molecular Formula | C42H42O8 |
| Molecular Weight | 674.79 g/mol |
| Exact Mass | 674.29 |
| IUPAC Name | 1-[2,6-dihydroxy-3-[(2S,3S,4S,5S,6R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-4-phenylmethoxyphenyl]ethanone |
| SMILES | CC(=O)c1c(O)cc(OCc2ccccc2)c([C@@H]2O[C@H](C)[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)c1O |
| InChI | InChI=1S/C42H42O8/c1-28(43)36-34(44)23-35(46-24-30-15-7-3-8-16-30)37(38(36)45)40-42(49-27-33-21-13-6-14-22-33)41(48-26-32-19-11-5-12-20-32)39(29(2)50-40)47-25-31-17-9-4-10-18-31/h3-23,29,39-42,44-45H,24-27H2,1-2H3/t29-,39+,40+,41+,42+/m1/s1 |
| InChIKey | PKWYDYMVAYQTGN-ZOCRQHECSA-N |
| XLogP | 8.10 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.79 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |