C47H51NO11 — CID 134837079
[(3R,6R)-4,5-diacetyloxy-2-methyl-6-[2-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indol-3-yl]oxan-3-yl] acetate (PubChem CID 134837079) has the molecular formula C47H51NO11 and a molecular weight of 805.92 g/mol. Its IUPAC name is [(3R,6R)-4,5-diacetyloxy-2-methyl-6-[2-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indol-3-yl]oxan-3-yl] acetate.
| Compound Name | [(3R,6R)-4,5-diacetyloxy-2-methyl-6-[2-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indol-3-yl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 134837079 |
| Molecular Formula | C47H51NO11 |
| Molecular Weight | 805.92 g/mol |
| Exact Mass | 805.35 |
| IUPAC Name | [(3R,6R)-4,5-diacetyloxy-2-methyl-6-[2-[(2S,5R)-6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]-1H-indol-3-yl]oxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@@H](c2c([C@@H]3OC(C)[C@@H](OCc4ccccc4)C(OCc4ccccc4)C3OCc3ccccc3)[nH]c3ccccc23)OC(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C47H51NO11/c1-28-40(52-25-33-17-9-6-10-18-33)44(53-26-34-19-11-7-12-20-34)45(54-27-35-21-13-8-14-22-35)43(56-28)39-38(36-23-15-16-24-37(36)48-39)42-47(59-32(5)51)46(58-31(4)50)41(29(2)55-42)57-30(3)49/h6-24,28-29,40-48H,25-27H2,1-5H3/t28?,29?,40-,41-,42-,43+,44?,45?,46?,47?/m1/s1 |
| InChIKey | YWJIFMLZFDJJJM-GHIHJEAXSA-N |
| XLogP | 7.64 |
| TPSA | 140.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.92 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|