C18H18N8O4S — CID 59763117
1-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide (PubChem CID 59763117) has the molecular formula C18H18N8O4S and a molecular weight of 442.46 g/mol. Its IUPAC name is 1-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide.
| Compound Name | 1-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 59763117 |
| Molecular Formula | C18H18N8O4S |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 1-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-2-sulfanylidene-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2c(c1)[nH]c(=S)n2C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H18N8O4S/c19-14-11-16(22-5-21-14)26(6-23-11)17-13(28)12(27)10(30-17)4-25-9-2-1-7(15(20)29)3-8(9)24-18(25)31/h1-3,5-6,10,12-13,17,27-28H,4H2,(H2,20,29)(H,24,31)(H2,19,21,22)/t10-,12-,13-,17-/m1/s1 |
| InChIKey | LBQPUSVNJVRXPW-CNEMSGBDSA-N |
| XLogP | -0.16 |
| TPSA | 183.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|