C27H40N2O6Si — CID 100942223
1-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 100942223) has the molecular formula C27H40N2O6Si and a molecular weight of 516.71 g/mol. Its IUPAC name is 1-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 100942223 |
| Molecular Formula | C27H40N2O6Si |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 1-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n3ccc(=O)n(COCc4ccccc4)c3=O)[C@@H]2O1 |
| InChI | InChI=1S/C27H40N2O6Si/c1-26(2,3)36(6,7)33-17-20-15-21(24-23(20)34-27(4,5)35-24)28-14-13-22(30)29(25(28)31)18-32-16-19-11-9-8-10-12-19/h8-14,20-21,23-24H,15-18H2,1-7H3/t20-,21-,23-,24+/m1/s1 |
| InChIKey | UEOZJIKRWPSJLG-KOVSNXQUSA-N |
| XLogP | 4.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|