C25H34N2O8Si — CID 10649581
1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 10649581) has the molecular formula C25H34N2O8Si and a molecular weight of 518.64 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10649581 |
| Molecular Formula | C25H34N2O8Si |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 1-[(2R,3R,3aR,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-5-oxo-3,4,7,7a-tetrahydro-2H-furo[2,3-c]pyran-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](n2ccc(=O)n(COCc3ccccc3)c2=O)O[C@@H]2COC(=O)C[C@@]21O |
| InChI | InChI=1S/C25H34N2O8Si/c1-24(2,3)36(4,5)35-21-22(34-18-15-33-20(29)13-25(18,21)31)26-12-11-19(28)27(23(26)30)16-32-14-17-9-7-6-8-10-17/h6-12,18,21-22,31H,13-16H2,1-5H3/t18-,21+,22-,25-/m1/s1 |
| InChIKey | PJCTWZDAXVQZIB-LALUYCJQSA-N |
| XLogP | 2.15 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|