C18H20ClN2O7PS — CID 172584759
1-[(4aR,6R,7R,7aR)-2-chloro-7-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 172584759) has the molecular formula C18H20ClN2O7PS and a molecular weight of 474.86 g/mol. Its IUPAC name is 1-[(4aR,6R,7R,7aR)-2-chloro-7-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(4aR,6R,7R,7aR)-2-chloro-7-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172584759 |
| Molecular Formula | C18H20ClN2O7PS |
| Molecular Weight | 474.86 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | 1-[(4aR,6R,7R,7aR)-2-chloro-7-methoxy-2-sulfanylidene-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | CO[C@@H]1[C@@H]2OP(=S)(Cl)OC[C@H]2O[C@H]1n1ccc(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C18H20ClN2O7PS/c1-24-16-15-13(10-26-29(19,30)28-15)27-17(16)20-8-7-14(22)21(18(20)23)11-25-9-12-5-3-2-4-6-12/h2-8,13,15-17H,9-11H2,1H3/t13-,15-,16-,17-,29?/m1/s1 |
| InChIKey | IKVIENRTHKGINO-WDJGLUJWSA-N |
| XLogP | 1.98 |
| TPSA | 90.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.86 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|