C33H34F2N2O6 — CID 175677961
1-[(2R,3S,4S,5R)-3,5-bis(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione (PubChem CID 175677961) has the molecular formula C33H34F2N2O6 and a molecular weight of 592.64 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R)-3,5-bis(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3S,4S,5R)-3,5-bis(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175677961 |
| Molecular Formula | C33H34F2N2O6 |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | 1-[(2R,3S,4S,5R)-3,5-bis(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-3-(phenylmethoxymethyl)pyrimidine-2,4-dione |
| SMILES | O=c1ccn([C@@H]2O[C@](CF)(COCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2CF)c(=O)n1COCc1ccccc1 |
| InChI | InChI=1S/C33H34F2N2O6/c34-18-28-30(42-21-27-14-8-3-9-15-27)33(22-35,23-40-19-25-10-4-1-5-11-25)43-31(28)36-17-16-29(38)37(32(36)39)24-41-20-26-12-6-2-7-13-26/h1-17,28,30-31H,18-24H2/t28-,30-,31+,33+/m0/s1 |
| InChIKey | XYVDPPIPFMSCSB-LBJLWFCUSA-N |
| XLogP | 4.81 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |