C44H41ClFN3O5 — CID 175677943
1-[(2R,3R,4R,5R)-3-chloro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one (PubChem CID 175677943) has the molecular formula C44H41ClFN3O5 and a molecular weight of 746.28 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3-chloro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3-chloro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 175677943 |
| Molecular Formula | C44H41ClFN3O5 |
| Molecular Weight | 746.28 g/mol |
| Exact Mass | 745.27 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3-chloro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-4-[[(4-methoxyphenyl)-diphenylmethyl]amino]pyrimidin-2-one |
| SMILES | COc1ccc(C(Nc2ccn([C@@H]3O[C@](CF)(COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H]3Cl)c(=O)n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C44H41ClFN3O5/c1-51-37-24-22-36(23-25-37)44(34-18-10-4-11-19-34,35-20-12-5-13-21-35)48-38-26-27-49(42(50)47-38)41-39(45)40(53-29-33-16-8-3-9-17-33)43(30-46,54-41)31-52-28-32-14-6-2-7-15-32/h2-27,39-41H,28-31H2,1H3,(H,47,48,50)/t39-,40+,41-,43-/m1/s1 |
| InChIKey | CBZIIOWUZWMNHY-ATOWIZEMSA-N |
| XLogP | 8.30 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.28 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|