C31H30FN3O4 — CID 87159478
(2S,3R,4R,5R)-4-fluoro-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]-3,4-dimethyloxolane-2-carbaldehyde (PubChem CID 87159478) has the molecular formula C31H30FN3O4 and a molecular weight of 527.60 g/mol. Its IUPAC name is (2S,3R,4R,5R)-4-fluoro-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]-3,4-dimethyloxolane-2-carbaldehyde.
| Compound Name | (2S,3R,4R,5R)-4-fluoro-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]-3,4-dimethyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 87159478 |
| Molecular Formula | C31H30FN3O4 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | (2S,3R,4R,5R)-4-fluoro-5-[4-[[(4-methoxyphenyl)-diphenylmethyl]amino]-2-oxopyrimidin-1-yl]-3,4-dimethyloxolane-2-carbaldehyde |
| SMILES | COc1ccc(C(Nc2ccn([C@@H]3O[C@H](C=O)[C@@H](C)[C@@]3(C)F)c(=O)n2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30FN3O4/c1-21-26(20-36)39-28(30(21,2)32)35-19-18-27(33-29(35)37)34-31(22-10-6-4-7-11-22,23-12-8-5-9-13-23)24-14-16-25(38-3)17-15-24/h4-21,26,28H,1-3H3,(H,33,34,37)/t21-,26-,28-,30-/m1/s1 |
| InChIKey | WLACXDYGXTWPGE-LYFQOWASSA-N |
| XLogP | 5.12 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|