C44H39ClFN5O4 — CID 140960207
(2R,3R,4S,5R)-2-[6-chloro-2-(tritylamino)purin-9-yl]-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol (PubChem CID 140960207) has the molecular formula C44H39ClFN5O4 and a molecular weight of 756.28 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-chloro-2-(tritylamino)purin-9-yl]-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol.
| Compound Name | (2R,3R,4S,5R)-2-[6-chloro-2-(tritylamino)purin-9-yl]-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 140960207 |
| Molecular Formula | C44H39ClFN5O4 |
| Molecular Weight | 756.28 g/mol |
| Exact Mass | 755.27 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-chloro-2-(tritylamino)purin-9-yl]-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-ol |
| SMILES | O[C@H]1[C@H](n2cnc3c(Cl)nc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)nc32)O[C@](CF)(COCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H39ClFN5O4/c45-39-36-40(49-42(48-39)50-44(33-20-10-3-11-21-33,34-22-12-4-13-23-34)35-24-14-5-15-25-35)51(30-47-36)41-37(52)38(54-27-32-18-8-2-9-19-32)43(28-46,55-41)29-53-26-31-16-6-1-7-17-31/h1-25,30,37-38,41,52H,26-29H2,(H,48,49,50)/t37-,38+,41-,43-/m1/s1 |
| InChIKey | BXYYISLKTFLVJI-JZBCXYDMSA-N |
| XLogP | 8.28 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.28 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|