C44H38ClF2N5O3 — CID 175677939
6-chloro-9-[(2R,3S,4R,5R)-3-fluoro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-N-tritylpurin-2-amine (PubChem CID 175677939) has the molecular formula C44H38ClF2N5O3 and a molecular weight of 758.27 g/mol. Its IUPAC name is 6-chloro-9-[(2R,3S,4R,5R)-3-fluoro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-N-tritylpurin-2-amine.
| Compound Name | 6-chloro-9-[(2R,3S,4R,5R)-3-fluoro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-N-tritylpurin-2-amine |
|---|---|
| PubChem CID | 175677939 |
| Molecular Formula | C44H38ClF2N5O3 |
| Molecular Weight | 758.27 g/mol |
| Exact Mass | 757.26 |
| IUPAC Name | 6-chloro-9-[(2R,3S,4R,5R)-3-fluoro-5-(fluoromethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]-N-tritylpurin-2-amine |
| SMILES | FC[C@]1(COCc2ccccc2)O[C@@H](n2cnc3c(Cl)nc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)nc32)[C@@H](F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H38ClF2N5O3/c45-39-37-40(50-42(49-39)51-44(33-20-10-3-11-21-33,34-22-12-4-13-23-34)35-24-14-5-15-25-35)52(30-48-37)41-36(47)38(54-27-32-18-8-2-9-19-32)43(28-46,55-41)29-53-26-31-16-6-1-7-17-31/h1-25,30,36,38,41H,26-29H2,(H,49,50,51)/t36-,38-,41+,43+/m0/s1 |
| InChIKey | RJPJCQFXJMHYMM-GROOBOCUSA-N |
| XLogP | 9.26 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.27 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|