C25H25N2O10P — CID 167378765
[(2R,3R,5R)-5-[2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]-4-methoxy-2-(phosphorosooxymethoxy)oxolan-3-yl] benzoate (PubChem CID 167378765) has the molecular formula C25H25N2O10P and a molecular weight of 544.45 g/mol. Its IUPAC name is [(2R,3R,5R)-5-[2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]-4-methoxy-2-(phosphorosooxymethoxy)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,5R)-5-[2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]-4-methoxy-2-(phosphorosooxymethoxy)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 167378765 |
| Molecular Formula | C25H25N2O10P |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | [(2R,3R,5R)-5-[2,4-dioxo-3-(phenylmethoxymethyl)pyrimidin-1-yl]-4-methoxy-2-(phosphorosooxymethoxy)oxolan-3-yl] benzoate |
| SMILES | COC1[C@@H](OC(=O)c2ccccc2)[C@@H](OCOP=O)O[C@H]1n1ccc(=O)n(COCc2ccccc2)c1=O |
| InChI | InChI=1S/C25H25N2O10P/c1-32-20-21(36-23(29)18-10-6-3-7-11-18)24(34-16-35-38-31)37-22(20)26-13-12-19(28)27(25(26)30)15-33-14-17-8-4-2-5-9-17/h2-13,20-22,24H,14-16H2,1H3/t20?,21-,22-,24+/m1/s1 |
| InChIKey | GJQVRNUFVROSIZ-NIDNNVSCSA-N |
| XLogP | 2.48 |
| TPSA | 133.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|