C28H40N8O4 — CID 67973751
1-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-1-(4-tert-butylphenyl)urea (PubChem CID 67973751) has the molecular formula C28H40N8O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 1-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-1-(4-tert-butylphenyl)urea.
| Compound Name | 1-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-1-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 67973751 |
| Molecular Formula | C28H40N8O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.32 |
| IUPAC Name | 1-[3-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl-methylamino]propyl]-1-(4-tert-butylphenyl)urea |
| SMILES | CN(CCCN(C(N)=O)c1ccc(C(C)(C)C)cc1)C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C28H40N8O4/c1-27(2,3)17-8-10-18(11-9-17)35(26(30)37)13-7-12-34(6)14-19-21-22(40-28(4,5)39-21)25(38-19)36-16-33-20-23(29)31-15-32-24(20)36/h8-11,15-16,19,21-22,25H,7,12-14H2,1-6H3,(H2,30,37)(H2,29,31,32)/t19-,21-,22-,25-/m1/s1 |
| InChIKey | XROVJKRTZSAJBU-PTGPVQHPSA-N |
| XLogP | 3.03 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |