C30H38F3N7O3 — CID 154470534
(2R,3R,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol (PubChem CID 154470534) has the molecular formula C30H38F3N7O3 and a molecular weight of 601.67 g/mol. Its IUPAC name is (2R,3R,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 154470534 |
| Molecular Formula | C30H38F3N7O3 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.30 |
| IUPAC Name | (2R,3R,4R)-4-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-2-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-(2,2,2-trifluoroethyl)amino]methyl]oxolane-3,4-diol |
| SMILES | CC(C)(C)c1ccc2nc(CCC3CC(N(C[C@H]4OC[C@](O)(n5ccc6c(N)ncnc65)[C@@H]4O)CC(F)(F)F)C3)[nH]c2c1 |
| InChI | InChI=1S/C30H38F3N7O3/c1-28(2,3)18-5-6-21-22(12-18)38-24(37-21)7-4-17-10-19(11-17)39(14-30(31,32)33)13-23-25(41)29(42,15-43-23)40-9-8-20-26(34)35-16-36-27(20)40/h5-6,8-9,12,16-17,19,23,25,41-42H,4,7,10-11,13-15H2,1-3H3,(H,37,38)(H2,34,35,36)/t17?,19?,23-,25-,29-/m1/s1 |
| InChIKey | XGVUIKGKFRZAIC-YDHUIMFVSA-N |
| XLogP | 3.87 |
| TPSA | 138.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |