C22H32N6O3 — CID 126703520
9-[(3aR,4R,6R,6aR)-6-[[(3-ethenylcyclobutyl)-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine (PubChem CID 126703520) has the molecular formula C22H32N6O3 and a molecular weight of 428.54 g/mol. Its IUPAC name is 9-[(3aR,4R,6R,6aR)-6-[[(3-ethenylcyclobutyl)-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine.
| Compound Name | 9-[(3aR,4R,6R,6aR)-6-[[(3-ethenylcyclobutyl)-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
|---|---|
| PubChem CID | 126703520 |
| Molecular Formula | C22H32N6O3 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 9-[(3aR,4R,6R,6aR)-6-[[(3-ethenylcyclobutyl)-propan-2-ylamino]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-6-amine |
| SMILES | C=CC1CC(N(C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)C(C)C)C1 |
| InChI | InChI=1S/C22H32N6O3/c1-6-13-7-14(8-13)27(12(2)3)9-15-17-18(31-22(4,5)30-17)21(29-15)28-11-26-16-19(23)24-10-25-20(16)28/h6,10-15,17-18,21H,1,7-9H2,2-5H3,(H2,23,24,25)/t13?,14?,15-,17-,18-,21-/m1/s1 |
| InChIKey | RBQFPICBUSLVSG-YYCZMQGOSA-N |
| XLogP | 2.50 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|