C29H34N6O10 — CID 10349004
5-O-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] 1-O-[3-[4-[(E)-2-nitroethenyl]phenoxy]propyl] pentanedioate (PubChem CID 10349004) has the molecular formula C29H34N6O10 and a molecular weight of 626.62 g/mol. Its IUPAC name is 5-O-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] 1-O-[3-[4-[(E)-2-nitroethenyl]phenoxy]propyl] pentanedioate.
| Compound Name | 5-O-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] 1-O-[3-[4-[(E)-2-nitroethenyl]phenoxy]propyl] pentanedioate |
|---|---|
| PubChem CID | 10349004 |
| Molecular Formula | C29H34N6O10 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | 5-O-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl] 1-O-[3-[4-[(E)-2-nitroethenyl]phenoxy]propyl] pentanedioate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COC(=O)CCCC(=O)OCCCOc1ccc(/C=C/[N+](=O)[O-])cc1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C29H34N6O10/c1-29(2)44-24-20(43-28(25(24)45-29)34-17-33-23-26(30)31-16-32-27(23)34)15-42-22(37)6-3-5-21(36)41-14-4-13-40-19-9-7-18(8-10-19)11-12-35(38)39/h7-12,16-17,20,24-25,28H,3-6,13-15H2,1-2H3,(H2,30,31,32)/b12-11+/t20-,24-,25-,28-/m1/s1 |
| InChIKey | BCPVHPKIESJACI-GEBMJWQESA-N |
| XLogP | 2.80 |
| TPSA | 202.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|