C23H29N5O9 — CID 101035952
[(2R,3S,6S)-6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 101035952) has the molecular formula C23H29N5O9 and a molecular weight of 519.51 g/mol. Its IUPAC name is [(2R,3S,6S)-6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101035952 |
| Molecular Formula | C23H29N5O9 |
| Molecular Weight | 519.51 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [(2R,3S,6S)-6-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]-3-acetyloxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@@H]3OC(C)(C)O[C@@H]32)C=C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H29N5O9/c1-11(29)31-7-14-13(33-12(2)30)5-6-16(34-14)32-8-15-18-19(37-23(3,4)36-18)22(35-15)28-10-27-17-20(24)25-9-26-21(17)28/h5-6,9-10,13-16,18-19,22H,7-8H2,1-4H3,(H2,24,25,26)/t13-,14+,15+,16-,18+,19+,22+/m0/s1 |
| InChIKey | AZWBZQFIDBGAJD-SNBOZFNFSA-N |
| XLogP | 0.62 |
| TPSA | 168.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.51 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|