C24H24N6O4 — CID 15216936
N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-carboxamide (PubChem CID 15216936) has the molecular formula C24H24N6O4 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 15216936 |
| Molecular Formula | C24H24N6O4 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]naphthalene-2-carboxamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CNC(=O)c1ccc3ccccc3c1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C24H24N6O4/c1-24(2)33-18-16(10-26-22(31)15-8-7-13-5-3-4-6-14(13)9-15)32-23(19(18)34-24)30-12-29-17-20(25)27-11-28-21(17)30/h3-9,11-12,16,18-19,23H,10H2,1-2H3,(H,26,31)(H2,25,27,28)/t16-,18-,19-,23-/m1/s1 |
| InChIKey | FXYYFNNWNRBVDM-DYVMYPEFSA-N |
| XLogP | 2.41 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |