C22H22ClN7O5S — CID 170392437
N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-2-chloroquinoline-6-sulfonamide (PubChem CID 170392437) has the molecular formula C22H22ClN7O5S and a molecular weight of 531.98 g/mol. Its IUPAC name is N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-2-chloroquinoline-6-sulfonamide.
| Compound Name | N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-2-chloroquinoline-6-sulfonamide |
|---|---|
| PubChem CID | 170392437 |
| Molecular Formula | C22H22ClN7O5S |
| Molecular Weight | 531.98 g/mol |
| Exact Mass | 531.11 |
| IUPAC Name | N-[[(3aR,4R,6R,6aR)-4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-2-chloroquinoline-6-sulfonamide |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CNS(=O)(=O)c1ccc3nc(Cl)ccc3c1)O[C@H]2n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C22H22ClN7O5S/c1-22(2)34-17-14(8-28-36(31,32)12-4-5-13-11(7-12)3-6-15(23)29-13)33-21(18(17)35-22)30-10-27-16-19(24)25-9-26-20(16)30/h3-7,9-10,14,17-18,21,28H,8H2,1-2H3,(H2,24,25,26)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | MYQBRHUBYGVGKZ-HAXDFEGKSA-N |
| XLogP | 2.01 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.98 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|