C25H28N8O6 — CID 22981578
N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)butanediamide (PubChem CID 22981578) has the molecular formula C25H28N8O6 and a molecular weight of 536.55 g/mol. Its IUPAC name is N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)butanediamide.
| Compound Name | N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)butanediamide |
|---|---|
| PubChem CID | 22981578 |
| Molecular Formula | C25H28N8O6 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-[[4-(6-aminopurin-9-yl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)butanediamide |
| SMILES | CC1(C)OC2C(CNC(=O)CCC(=O)Nc3cccc4c3CNC4=O)OC(n3cnc4c(N)ncnc43)C2O1 |
| InChI | InChI=1S/C25H28N8O6/c1-25(2)38-19-15(37-24(20(19)39-25)33-11-31-18-21(26)29-10-30-22(18)33)9-27-16(34)6-7-17(35)32-14-5-3-4-12-13(14)8-28-23(12)36/h3-5,10-11,15,19-20,24H,6-9H2,1-2H3,(H,27,34)(H,28,36)(H,32,35)(H2,26,29,30) |
| InChIKey | XSRSPBJKHKKNEX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 184.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |