C21H22N8O6 — CID 10167509
N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)propanediamide (PubChem CID 10167509) has the molecular formula C21H22N8O6 and a molecular weight of 482.46 g/mol. Its IUPAC name is N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)propanediamide.
| Compound Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)propanediamide |
|---|---|
| PubChem CID | 10167509 |
| Molecular Formula | C21H22N8O6 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl]-N'-(1-oxo-2,3-dihydroisoindol-4-yl)propanediamide |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CNC(=O)CC(=O)Nc2cccc3c2CNC3=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22N8O6/c22-18-15-19(26-7-25-18)29(8-27-15)21-17(33)16(32)12(35-21)6-23-13(30)4-14(31)28-11-3-1-2-9-10(11)5-24-20(9)34/h1-3,7-8,12,16-17,21,32-33H,4-6H2,(H,23,30)(H,24,34)(H,28,31)(H2,22,25,26)/t12-,16-,17-,21-/m1/s1 |
| InChIKey | BJQIMLHZLUVEMV-AQZHONCQSA-N |
| XLogP | -1.58 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|